CAS 596-01-0 appears in our catalog under these names: 3,3–Bis(4–hydroxynaphthalen–1–yl)isobenzofuran–1(3H)–one, alpha-Naphtholphthalein , alpha-Naphtholphthalein, >98.0%(HPLC), alpha-Naphtholphthalein, alpha-Naphtholphthalein, pure, indicator. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Chemat, Thermo Scientific (Acros). Available pack sizes: 5g, 1g, 25g, 10g, 100g, 1 g, 50 mg, 100 mg.
3,3-bis(4-hydroxynaphthalen-1-yl)-2-benzofuran-1-one (CAS 596-01-0) is a chemical compound with the molecular formula C28H18O4 and a molecular weight of 418.4 g/mol. IUPAC name: 3,3-bis(4-hydroxynaphthalen-1-yl)-2-benzofuran-1-one. InChIKey: HQHBAGKIEAOSNM-UHFFFAOYSA-N.
| Molecular formula | C28H18O4 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | 3,3-bis(4-hydroxynaphthalen-1-yl)-2-benzofuran-1-one |
| InChIKey | HQHBAGKIEAOSNM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2O)C3(C4=CC=CC=C4C(=O)O3)C5=CC=C(C6=CC=CC=C65)O |
Computed by PubChem (NCBI)