Products 2172939-31-8
CAS 2172939-31-8 is the registry number for 4,4'-((9H-Fluoren-9-ylidene)methylene)dibenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[(4-carboxyphenyl)-fluoren-9-ylidenemethyl]benzoic acid (CAS 2172939-31-8) is a chemical compound with the molecular formula C28H18O4 and a molecular weight of 418.4 g/mol. IUPAC name: 4-[(4-carboxyphenyl)-fluoren-9-ylidenemethyl]benzoic acid. InChIKey: IGOXHLLOVNEMBN-UHFFFAOYSA-N.
| Molecular formula | C28H18O4 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | 4-[(4-carboxyphenyl)-fluoren-9-ylidenemethyl]benzoic acid |
| InChIKey | IGOXHLLOVNEMBN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C2=C(C4=CC=C(C=C4)C(=O)O)C5=CC=C(C=C5)C(=O)O |
Computed by PubChem (NCBI)