Products 1818326-13-4
CAS 1818326-13-4 is the registry number for 3,3'-(Anthracene-9,10-diyl)dibenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[10-(3-carboxyphenyl)anthracen-9-yl]benzoic acid (CAS 1818326-13-4) is a chemical compound with the molecular formula C28H18O4 and a molecular weight of 418.4 g/mol. IUPAC name: 3-[10-(3-carboxyphenyl)anthracen-9-yl]benzoic acid. InChIKey: TYMKHBAPXYHUNF-UHFFFAOYSA-N.
| Molecular formula | C28H18O4 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | 3-[10-(3-carboxyphenyl)anthracen-9-yl]benzoic acid |
| InChIKey | TYMKHBAPXYHUNF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2C4=CC(=CC=C4)C(=O)O)C5=CC(=CC=C5)C(=O)O |
Computed by PubChem (NCBI)