CAS 42824-53-3 appears in our catalog under these names: 4,4'–(Anthracene–9,10–diyl)dibenzoic acid, 9,10-Di(p-carboxyphenyl)anthracene, 99%, 99%, 4,4'-(Anthracene-9,10-diyl)dibenzoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 15g, 100mg, 250mg, 25g, 100g.
4-[10-(4-carboxyphenyl)anthracen-9-yl]benzoic acid (CAS 42824-53-3) is a chemical compound with the molecular formula C28H18O4 and a molecular weight of 418.4 g/mol. IUPAC name: 4-[10-(4-carboxyphenyl)anthracen-9-yl]benzoic acid. InChIKey: ZSLCDSMUKOZRPQ-UHFFFAOYSA-N.
| Molecular formula | C28H18O4 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | 4-[10-(4-carboxyphenyl)anthracen-9-yl]benzoic acid |
| InChIKey | ZSLCDSMUKOZRPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2C4=CC=C(C=C4)C(=O)O)C5=CC=C(C=C5)C(=O)O |
Computed by PubChem (NCBI)