Products 2757730-33-7
CAS 2757730-33-7 is the registry number for Ethyl 4-Aminoquinoline-6-Carboxylate Hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 4-aminoquinoline-6-carboxylate;hydrochloride (CAS 2757730-33-7) is a chemical compound with the molecular formula C12H13ClN2O2 and a molecular weight of 252.69 g/mol. IUPAC name: ethyl 4-aminoquinoline-6-carboxylate;hydrochloride. InChIKey: AQWCSZLCXWDYRL-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O2 |
|---|---|
| Molecular weight | 252.69 g/mol |
| IUPAC name | ethyl 4-aminoquinoline-6-carboxylate;hydrochloride |
| InChIKey | AQWCSZLCXWDYRL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=CN=C2C=C1)N.Cl |
Computed by PubChem (NCBI)