CAS 275816-73-4 is the registry number for Fmoc-Gly-CHN2. Offered by: Creative Peptides. Available pack sizes: 1g.
9H-fluoren-9-ylmethyl N-(3-diazo-2-oxopropyl)carbamate (CAS 275816-73-4) is a chemical compound with the molecular formula C18H15N3O3 and a molecular weight of 321.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(3-diazo-2-oxopropyl)carbamate. InChIKey: DLDGJOVHMQKZMI-UHFFFAOYSA-N.
| Molecular formula | C18H15N3O3 |
|---|---|
| Molecular weight | 321.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(3-diazo-2-oxopropyl)carbamate |
| InChIKey | DLDGJOVHMQKZMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(=O)C=[N+]=[N-] |
Computed by PubChem (NCBI)