CAS 442565-10-8 is the registry number for 2-((5-methyl-3-phenylisoxazol-4-yl)carbonylamino)benzamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(2-carbamoylphenyl)-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide (CAS 442565-10-8) is a chemical compound with the molecular formula C18H15N3O3 and a molecular weight of 321.3 g/mol. IUPAC name: N-(2-carbamoylphenyl)-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide. InChIKey: MOVZCRONUOIENV-UHFFFAOYSA-N.
| Molecular formula | C18H15N3O3 |
|---|---|
| Molecular weight | 321.3 g/mol |
| IUPAC name | N-(2-carbamoylphenyl)-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide |
| InChIKey | MOVZCRONUOIENV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C(=O)NC3=CC=CC=C3C(=O)N |
Computed by PubChem (NCBI)