Products 857064-42-7
CAS 857064-42-7 is the registry number for WP-1034. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-2-cyano-3-(4-nitrophenyl)-N-[(1R)-1-phenylethyl]prop-2-enamide (CAS 857064-42-7) is a chemical compound with the molecular formula C18H15N3O3 and a molecular weight of 321.3 g/mol. IUPAC name: (E)-2-cyano-3-(4-nitrophenyl)-N-[(1R)-1-phenylethyl]prop-2-enamide. InChIKey: RYYNDHCHTCVQJH-KWWJGWKXSA-N.
| Molecular formula | C18H15N3O3 |
|---|---|
| Molecular weight | 321.3 g/mol |
| IUPAC name | (E)-2-cyano-3-(4-nitrophenyl)-N-[(1R)-1-phenylethyl]prop-2-enamide |
| InChIKey | RYYNDHCHTCVQJH-KWWJGWKXSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NC(=O)/C(=C/C2=CC=C(C=C2)[N+](=O)[O-])/C#N |
Computed by PubChem (NCBI)