CAS 903440-36-8 is the registry number for 2-(3,4-Dimethoxyphenyl)pyrimido[1,2-a]benzimidazol-4(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3,4-dimethoxyphenyl)-1H-pyrimido[1,2-a]benzimidazol-4-one (CAS 903440-36-8) is a chemical compound with the molecular formula C18H15N3O3 and a molecular weight of 321.3 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-1H-pyrimido[1,2-a]benzimidazol-4-one. InChIKey: MLIPCSKLNQGSJP-UHFFFAOYSA-N.
| Molecular formula | C18H15N3O3 |
|---|---|
| Molecular weight | 321.3 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-1H-pyrimido[1,2-a]benzimidazol-4-one |
| InChIKey | MLIPCSKLNQGSJP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=O)N3C4=CC=CC=C4N=C3N2)OC |
Computed by PubChem (NCBI)