Products 2758673-07-1
CAS 2758673-07-1 appears in our catalog under these names: Nurr1 inverse agonist-1, Nurr1 inverse agonist-1, 98.83%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 2mg, 10mg, 50mg, 50 mg, 5 mg, 100 mg, 10 mg.
Methyl 1-methyl-5-pyridin-3-ylindole-3-carboxylate (CAS 2758673-07-1) is a chemical compound with the molecular formula C16H14N2O2 and a molecular weight of 266.29 g/mol. IUPAC name: methyl 1-methyl-5-pyridin-3-ylindole-3-carboxylate. InChIKey: CPJVLZDDECEONQ-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O2 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | methyl 1-methyl-5-pyridin-3-ylindole-3-carboxylate |
| InChIKey | CPJVLZDDECEONQ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C=CC(=C2)C3=CN=CC=C3)C(=O)OC |
Computed by PubChem (NCBI)