CAS 2760266-20-2 is the registry number for 2-Methyl-6-(5-methyl-3,4,5,6-tetrahydropyridin-2-yl)quinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-6-(3-methyl-2,3,4,5-tetrahydropyridin-6-yl)quinoline (CAS 2760266-20-2) is a chemical compound with the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. IUPAC name: 2-methyl-6-(3-methyl-2,3,4,5-tetrahydropyridin-6-yl)quinoline. InChIKey: XXWOYGIKLSFVMR-UHFFFAOYSA-N.
| Molecular formula | C16H18N2 |
|---|---|
| Molecular weight | 238.33 g/mol |
| IUPAC name | 2-methyl-6-(3-methyl-2,3,4,5-tetrahydropyridin-6-yl)quinoline |
| InChIKey | XXWOYGIKLSFVMR-UHFFFAOYSA-N |
| SMILES | CC1CCC(=NC1)C2=CC3=C(C=C2)N=C(C=C3)C |
Computed by PubChem (NCBI)