Products 2760487-63-4
CAS 2760487-63-4 is the registry number for tert-Butyl (5-amino-3-ethylpyridin-2-yl)carbamate, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Tert-butyl N-(5-amino-3-ethyl-2-pyridinyl)carbamate (CAS 2760487-63-4) is a chemical compound with the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. IUPAC name: tert-butyl N-(5-amino-3-ethyl-2-pyridinyl)carbamate. InChIKey: PDLQUYCSFQDJIY-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O2 |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | tert-butyl N-(5-amino-3-ethyl-2-pyridinyl)carbamate |
| InChIKey | PDLQUYCSFQDJIY-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=CC(=C1)N)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)