CAS 27613-31-6 is the registry number for 3,4,6-Trihydroxy-2-methylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4,6-trihydroxy-2-methylbenzoic acid (CAS 27613-31-6) is a chemical compound with the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. IUPAC name: 3,4,6-trihydroxy-2-methylbenzoic acid. InChIKey: NXNCXCHKAILAOR-UHFFFAOYSA-N.
| Molecular formula | C8H8O5 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 3,4,6-trihydroxy-2-methylbenzoic acid |
| InChIKey | NXNCXCHKAILAOR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1O)O)O)C(=O)O |
Computed by PubChem (NCBI)