Products 2762612-34-8
CAS 2762612-34-8 is the registry number for 3-(1-Oxo-5-(4-oxopiperidin-1-yl)isoindolin-2-yl)piperidine-2,6-dione, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-[3-oxo-6-(4-oxopiperidin-1-yl)-1H-isoindol-2-yl]piperidine-2,6-dione (CAS 2762612-34-8) is a chemical compound with the molecular formula C18H19N3O4 and a molecular weight of 341.4 g/mol. IUPAC name: 3-[3-oxo-6-(4-oxopiperidin-1-yl)-1H-isoindol-2-yl]piperidine-2,6-dione. InChIKey: MOUYUPAFHMXXRV-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O4 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 3-[3-oxo-6-(4-oxopiperidin-1-yl)-1H-isoindol-2-yl]piperidine-2,6-dione |
| InChIKey | MOUYUPAFHMXXRV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC(=C3)N4CCC(=O)CC4 |
Computed by PubChem (NCBI)