CAS 2763749-29-5 appears in our catalog under these names: 3-(6-Amino-1-oxoisoindolin-2-yl)-1-methylpiperidine-2,6-dione, 98%, N-Methyl-desamino lenalidomide-NH2. Offered by: AmBeed, MedChemExpress. Available pack sizes: 1g, 5g, Get quote.
3-(5-amino-3-oxo-1H-isoindol-2-yl)-1-methylpiperidine-2,6-dione (CAS 2763749-29-5) is a chemical compound with the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. IUPAC name: 3-(5-amino-3-oxo-1H-isoindol-2-yl)-1-methylpiperidine-2,6-dione. InChIKey: CAZZZPLILVNKBD-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O3 |
|---|---|
| Molecular weight | 273.29 g/mol |
| IUPAC name | 3-(5-amino-3-oxo-1H-isoindol-2-yl)-1-methylpiperidine-2,6-dione |
| InChIKey | CAZZZPLILVNKBD-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CCC(C1=O)N2CC3=C(C2=O)C=C(C=C3)N |
Computed by PubChem (NCBI)