CAS 2763750-05-4 is the registry number for 2-Chlorofuro(3,4-b)pyridin-5(7H)-one, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-chloro-7H-furo[3,4-b]pyridin-5-one (CAS 2763750-05-4) is a chemical compound with the molecular formula C7H4ClNO2 and a molecular weight of 169.56 g/mol. IUPAC name: 2-chloro-7H-furo[3,4-b]pyridin-5-one. InChIKey: OFWJPUYVLGHHOW-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO2 |
|---|---|
| Molecular weight | 169.56 g/mol |
| IUPAC name | 2-chloro-7H-furo[3,4-b]pyridin-5-one |
| InChIKey | OFWJPUYVLGHHOW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=N2)Cl)C(=O)O1 |
Computed by PubChem (NCBI)