CAS 285991-64-2 appears in our catalog under these names: 4-Chlorofuro(3,4-c)pyridin-3(1H)-one, 97%, 4-Chlorofuro[3,4-c]pyridin-3(1H)-one, 97%, 97%, 4-chloro-1H-furo[3,4-c]pyridin-3-one, 9500%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g, 10g.
4-chloro-1H-furo[3,4-c]pyridin-3-one (CAS 285991-64-2) is a chemical compound with the molecular formula C7H4ClNO2 and a molecular weight of 169.56 g/mol. IUPAC name: 4-chloro-1H-furo[3,4-c]pyridin-3-one. InChIKey: BTBJIUHKFHYPHT-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO2 |
|---|---|
| Molecular weight | 169.56 g/mol |
| IUPAC name | 4-chloro-1H-furo[3,4-c]pyridin-3-one |
| InChIKey | BTBJIUHKFHYPHT-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=NC=C2)Cl)C(=O)O1 |
Computed by PubChem (NCBI)