CAS 1185173-60-7 appears in our catalog under these names: Chlorzoxazone-d3, Chlorzoxazone-4,6,7-d3, >95% (HPLC), Chlorzoxazone-4,6,7-d3, 98 atom % D, min 98% Chemical Purity, Chlorzoxazone–d3, Chlorzoxazone-d3, 98.54%. Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 2,5mg, 0,01g, 0,005g, 5 mg, 1 mg.
5-chloro-4,6,7-trideuterio-3H-1,3-benzoxazol-2-one (CAS 1185173-60-7) is a chemical compound with the molecular formula C7H4ClNO2 and a molecular weight of 172.58 g/mol. IUPAC name: 5-chloro-4,6,7-trideuterio-3H-1,3-benzoxazol-2-one. InChIKey: TZFWDZFKRBELIQ-CBYSEHNBSA-N.
| Molecular formula | C7H4ClNO2 |
|---|---|
| Molecular weight | 172.58 g/mol |
| IUPAC name | 5-chloro-4,6,7-trideuterio-3H-1,3-benzoxazol-2-one |
| InChIKey | TZFWDZFKRBELIQ-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C2=C1OC(=O)N2)[2H])Cl)[2H] |
Computed by PubChem (NCBI)