CAS 83972-30-9 is the registry number for 7-Chloro-2,3-dihydro-1,3-benzoxazol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-chloro-3H-1,3-benzoxazol-2-one (CAS 83972-30-9) is a chemical compound with the molecular formula C7H4ClNO2 and a molecular weight of 169.56 g/mol. IUPAC name: 7-chloro-3H-1,3-benzoxazol-2-one. InChIKey: PKVSEKISDMDLAQ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO2 |
|---|---|
| Molecular weight | 169.56 g/mol |
| IUPAC name | 7-chloro-3H-1,3-benzoxazol-2-one |
| InChIKey | PKVSEKISDMDLAQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)OC(=O)N2 |
Computed by PubChem (NCBI)