Products 2763754-88-5
CAS 2763754-88-5 is the registry number for 4-(2-aminoethyl)-4-azatricyclo[5.2.1.0,2,6]dec-8-ene-3,5-dione hydrochloride, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(2-aminoethyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;hydrochloride (CAS 2763754-88-5) is a chemical compound with the molecular formula C11H15ClN2O2 and a molecular weight of 242.70 g/mol. IUPAC name: 4-(2-aminoethyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;hydrochloride. InChIKey: ZTVVGBVMCYNSQD-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 4-(2-aminoethyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;hydrochloride |
| InChIKey | ZTVVGBVMCYNSQD-UHFFFAOYSA-N |
| SMILES | C1C2C=CC1C3C2C(=O)N(C3=O)CCN.Cl |
Computed by PubChem (NCBI)