Products 38944-11-5
CAS 38944-11-5 is the registry number for 5-(3,4-Dichlorophenyl)-3,4-dihydro-2H-pyrrole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3,4-dichlorophenyl)-3,4-dihydro-2H-pyrrole (CAS 38944-11-5) is a chemical compound with the molecular formula C10H9Cl2N and a molecular weight of 214.09 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)-3,4-dihydro-2H-pyrrole. InChIKey: MFAMNNGOAFYHFY-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2N |
|---|---|
| Molecular weight | 214.09 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)-3,4-dihydro-2H-pyrrole |
| InChIKey | MFAMNNGOAFYHFY-UHFFFAOYSA-N |
| SMILES | C1CC(=NC1)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)