Products 858018-99-2
CAS 858018-99-2 is the registry number for 3-Chloronaphthalen-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-chloronaphthalen-1-amine;hydrochloride (CAS 858018-99-2) is a chemical compound with the molecular formula C10H9Cl2N and a molecular weight of 214.09 g/mol. IUPAC name: 3-chloronaphthalen-1-amine;hydrochloride. InChIKey: WHCVHXAJJARGSZ-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2N |
|---|---|
| Molecular weight | 214.09 g/mol |
| IUPAC name | 3-chloronaphthalen-1-amine;hydrochloride |
| InChIKey | WHCVHXAJJARGSZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2N)Cl.Cl |
Computed by PubChem (NCBI)