CAS 76884-33-8 is the registry number for 3-Chloromethyl-Isoquinoline. Offered by: Chemat Brand. Available pack sizes: on request.
3-(chloromethyl)isoquinoline;hydrochloride (CAS 76884-33-8) is a chemical compound with the molecular formula C10H9Cl2N and a molecular weight of 214.09 g/mol. IUPAC name: 3-(chloromethyl)isoquinoline;hydrochloride. InChIKey: YETGNODBVXTTEB-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2N |
|---|---|
| Molecular weight | 214.09 g/mol |
| IUPAC name | 3-(chloromethyl)isoquinoline;hydrochloride |
| InChIKey | YETGNODBVXTTEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=NC(=CC2=C1)CCl.Cl |
Computed by PubChem (NCBI)