Products 2764865-33-8
CAS 2764865-33-8 is the registry number for Cdc7-IN-12. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-methyl-2-pyridin-4-yl-12-oxa-3-thia-6-azatricyclo[6.4.1.04,13]trideca-1,4(13),7-trien-5-one (CAS 2764865-33-8) is a chemical compound with the molecular formula C16H14N2O2S and a molecular weight of 298.4 g/mol. IUPAC name: 7-methyl-2-pyridin-4-yl-12-oxa-3-thia-6-azatricyclo[6.4.1.04,13]trideca-1,4(13),7-trien-5-one. InChIKey: HJLSSFDPYVHZRL-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O2S |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 7-methyl-2-pyridin-4-yl-12-oxa-3-thia-6-azatricyclo[6.4.1.04,13]trideca-1,4(13),7-trien-5-one |
| InChIKey | HJLSSFDPYVHZRL-UHFFFAOYSA-N |
| SMILES | CC1=C2CCCOC3=C(SC(=C23)C(=O)N1)C4=CC=NC=C4 |
Computed by PubChem (NCBI)
Synonyms:
Cdc7-IN-12, orb1689370