CAS 2765269-49-4 is the registry number for 6,6-Dimethyl-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine-2-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,6-dimethyl-4,7-dihydropyrazolo[5,1-c][1,4]oxazine-2-carbaldehyde (CAS 2765269-49-4) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: 6,6-dimethyl-4,7-dihydropyrazolo[5,1-c][1,4]oxazine-2-carbaldehyde. InChIKey: RMUOHIVATKKJTG-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 6,6-dimethyl-4,7-dihydropyrazolo[5,1-c][1,4]oxazine-2-carbaldehyde |
| InChIKey | RMUOHIVATKKJTG-UHFFFAOYSA-N |
| SMILES | CC1(CN2C(=CC(=N2)C=O)CO1)C |
Computed by PubChem (NCBI)