Products 2766623-38-3
CAS 2766623-38-3 appears in our catalog under these names: BZ1, 5-((4-(2-Aminoethyl)phenyl)amino)-4-chloro-2-methylpyridazin-3(2H)-one, 98%, 98%, BPTF-IN-BZ1, 98.31%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 5mg, 1mg, 10mg, 50mg, 10mM/1mL, 100 mg, 50 mg.
5-[4-(2-aminoethyl)anilino]-4-chloro-2-methylpyridazin-3-one (CAS 2766623-38-3) is a chemical compound with the molecular formula C13H15ClN4O and a molecular weight of 278.74 g/mol. IUPAC name: 5-[4-(2-aminoethyl)anilino]-4-chloro-2-methylpyridazin-3-one. InChIKey: UOQAFGWMKNIVAR-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN4O |
|---|---|
| Molecular weight | 278.74 g/mol |
| IUPAC name | 5-[4-(2-aminoethyl)anilino]-4-chloro-2-methylpyridazin-3-one |
| InChIKey | UOQAFGWMKNIVAR-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(C=N1)NC2=CC=C(C=C2)CCN)Cl |
Computed by PubChem (NCBI)