Products 443097-57-2
CAS 443097-57-2 appears in our catalog under these names: WAY-273339, ≥95%, ≥95%, IGF-1R inhibitor-4. Offered by: Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, Get quote.
6-tert-butyl-3-(4-chloroanilino)-4H-1,2,4-triazin-5-one (CAS 443097-57-2) is a chemical compound with the molecular formula C13H15ClN4O and a molecular weight of 278.74 g/mol. IUPAC name: 6-tert-butyl-3-(4-chloroanilino)-4H-1,2,4-triazin-5-one. InChIKey: CACKBTKGBYVNRL-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN4O |
|---|---|
| Molecular weight | 278.74 g/mol |
| IUPAC name | 6-tert-butyl-3-(4-chloroanilino)-4H-1,2,4-triazin-5-one |
| InChIKey | CACKBTKGBYVNRL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN=C(NC1=O)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)