Products 2990770-48-2
CAS 2990770-48-2 appears in our catalog under these names: CL097 hydrochloride, CL097 (hydrochloride), 99.96%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 5 mg, 10mM/1mL, 10 mg.
2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine;hydrochloride (CAS 2990770-48-2) is a chemical compound with the molecular formula C13H15ClN4O and a molecular weight of 278.74 g/mol. IUPAC name: 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine;hydrochloride. InChIKey: KTOHDRYYPGXUNP-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN4O |
|---|---|
| Molecular weight | 278.74 g/mol |
| IUPAC name | 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine;hydrochloride |
| InChIKey | KTOHDRYYPGXUNP-UHFFFAOYSA-N |
| SMILES | CCOCC1=NC2=C(N1)C(=NC3=CC=CC=C32)N.Cl |
Computed by PubChem (NCBI)