CAS 68936-13-0 appears in our catalog under these names: 4-[(E)-(4-Methoxyphenyl)diazenyl]benzene-1,3-diamine, 95%, Methoxy Red, Methoxy Red, >85.0%(T), Methoxyred, 4-[(E)-(4-methoxyphenyl)diazenyl]benzene-1,3-diamine, 85%(T). Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
4-[(4-methoxyphenyl)diazenyl]benzene-1,3-diamine;hydrochloride (CAS 68936-13-0) is a chemical compound with the molecular formula C13H15ClN4O and a molecular weight of 278.74 g/mol. IUPAC name: 4-[(4-methoxyphenyl)diazenyl]benzene-1,3-diamine;hydrochloride. InChIKey: NKGWQPAKARFOPX-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN4O |
|---|---|
| Molecular weight | 278.74 g/mol |
| IUPAC name | 4-[(4-methoxyphenyl)diazenyl]benzene-1,3-diamine;hydrochloride |
| InChIKey | NKGWQPAKARFOPX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N=NC2=C(C=C(C=C2)N)N.Cl |
Computed by PubChem (NCBI)