Products 2768326-37-8
CAS 2768326-37-8 appears in our catalog under these names: C5 Lenalidomide-CH3, C5 Lenalidomide-CH3, 98%. Offered by: MedChemExpress, Fluorochem. Available pack sizes: Get quote, 500mg, 1g.
3-(6-amino-3-oxo-1H-isoindol-2-yl)-1-methylpiperidine-2,6-dione (CAS 2768326-37-8) is a chemical compound with the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. IUPAC name: 3-(6-amino-3-oxo-1H-isoindol-2-yl)-1-methylpiperidine-2,6-dione. InChIKey: CMHQPTBPDFUNKW-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O3 |
|---|---|
| Molecular weight | 273.29 g/mol |
| IUPAC name | 3-(6-amino-3-oxo-1H-isoindol-2-yl)-1-methylpiperidine-2,6-dione |
| InChIKey | CMHQPTBPDFUNKW-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CCC(C1=O)N2CC3=C(C2=O)C=CC(=C3)N |
Computed by PubChem (NCBI)