Products 2768663-51-8
CAS 2768663-51-8 is the registry number for SN05, 98.37%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 25 mg, 100 mg, 50 mg, 1 mg, 10mM/1mL.
(2S,4S)-4-(4-phenylbenzoyl)oxypyrrolidine-2-carboxylic acid (CAS 2768663-51-8) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: (2S,4S)-4-(4-phenylbenzoyl)oxypyrrolidine-2-carboxylic acid. InChIKey: GCIZCIZLSHSWDS-HOTGVXAUSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | (2S,4S)-4-(4-phenylbenzoyl)oxypyrrolidine-2-carboxylic acid |
| InChIKey | GCIZCIZLSHSWDS-HOTGVXAUSA-N |
| SMILES | C1[C@@H](CN[C@@H]1C(=O)O)OC(=O)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)