CAS 2768872-22-4 is the registry number for 8-Bromoquinoxalin-6-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromoquinoxalin-6-ol (CAS 2768872-22-4) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 8-bromoquinoxalin-6-ol. InChIKey: OVQBUOJVKKAYBI-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 8-bromoquinoxalin-6-ol |
| InChIKey | OVQBUOJVKKAYBI-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=CC(=CC2=N1)O)Br |
Computed by PubChem (NCBI)