CAS 27693-42-1 is the registry number for 2-(3,4-Dimethoxybenzoyl)pyridine. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
(3,4-dimethoxyphenyl)-pyridin-2-ylmethanone (CAS 27693-42-1) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: (3,4-dimethoxyphenyl)-pyridin-2-ylmethanone. InChIKey: CUTYZBYXXYWWHB-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | (3,4-dimethoxyphenyl)-pyridin-2-ylmethanone |
| InChIKey | CUTYZBYXXYWWHB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C2=CC=CC=N2)OC |
Computed by PubChem (NCBI)