Products 2770348-65-5
CAS 2770348-65-5 is the registry number for Ethyl (1S,2S)-2-(3-(aminomethyl)pyrazin-2-yl)cyclopropane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-ethyl (1S,2S)-2-[3-(aminomethyl)pyrazin-2-yl]cyclopropane-1-carboxylate (CAS 2770348-65-5) is a chemical compound with the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. IUPAC name: trans-ethyl (1S,2S)-2-[3-(aminomethyl)pyrazin-2-yl]cyclopropane-1-carboxylate. InChIKey: XWEZNMDCXCAWCG-YUMQZZPRSA-N.
| Molecular formula | C11H15N3O2 |
|---|---|
| Molecular weight | 221.26 g/mol |
| IUPAC name | trans-ethyl (1S,2S)-2-[3-(aminomethyl)pyrazin-2-yl]cyclopropane-1-carboxylate |
| InChIKey | XWEZNMDCXCAWCG-YUMQZZPRSA-N |
| SMILES | CCOC(=O)[C@H]1C[C@@H]1C2=NC=CN=C2CN |
Computed by PubChem (NCBI)