Products 2776208-52-5
CAS 2776208-52-5 is the registry number for tert-Butyl ((1R,2S)-2-(1,3-dioxoisoindolin-2-yl)-2,3-dihydro-1H-inden-1-yl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1R,2S)-2-(1,3-dioxoisoindol-2-yl)-2,3-dihydro-1H-inden-1-yl]carbamate (CAS 2776208-52-5) is a chemical compound with the molecular formula C22H22N2O4 and a molecular weight of 378.4 g/mol. IUPAC name: tert-butyl N-[(1R,2S)-2-(1,3-dioxoisoindol-2-yl)-2,3-dihydro-1H-inden-1-yl]carbamate. InChIKey: ZNFINNBBJPWDNC-ZWKOTPCHSA-N.
| Molecular formula | C22H22N2O4 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | tert-butyl N-[(1R,2S)-2-(1,3-dioxoisoindol-2-yl)-2,3-dihydro-1H-inden-1-yl]carbamate |
| InChIKey | ZNFINNBBJPWDNC-ZWKOTPCHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1[C@H](CC2=CC=CC=C12)N3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)