Products 788152-32-9

CAS 788152-32-9 is the registry number for Selexipag Impurity 31. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[4-(5,6-diphenylpyrazin-2-yl)oxybutoxy]acetic acid (CAS 788152-32-9) is a chemical compound with the molecular formula C22H22N2O4 and a molecular weight of 378.4 g/mol. IUPAC name: 2-[4-(5,6-diphenylpyrazin-2-yl)oxybutoxy]acetic acid. InChIKey: CUMRQUGUQPEUGN-UHFFFAOYSA-N.

Identity
Molecular formulaC22H22N2O4
Molecular weight378.4 g/mol
IUPAC name2-[4-(5,6-diphenylpyrazin-2-yl)oxybutoxy]acetic acid
InChIKeyCUMRQUGUQPEUGN-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NC=C(N=C2C3=CC=CC=C3)OCCCCOCC(=O)O

Computed by PubChem (NCBI)