Products 1007358-76-0
CAS 1007358-76-0 appears in our catalog under these names: (R)-Ambrisentan, Ambrisentan Impurity 2（Ambrisentan R-Isomer）, (R)-Ambrisentan, >95% (HPLC), (R)–AMbrisentan, AMBRISENTAN R-ENANTIOMER. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 5mg.
(2R)-2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoic acid (CAS 1007358-76-0) is a chemical compound with the molecular formula C22H22N2O4 and a molecular weight of 378.4 g/mol. IUPAC name: (2R)-2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoic acid. InChIKey: OUJTZYPIHDYQMC-IBGZPJMESA-N.
| Molecular formula | C22H22N2O4 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | (2R)-2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoic acid |
| InChIKey | OUJTZYPIHDYQMC-IBGZPJMESA-N |
| SMILES | CC1=CC(=NC(=N1)O[C@@H](C(=O)O)C(C2=CC=CC=C2)(C3=CC=CC=C3)OC)C |
Computed by PubChem (NCBI)