CAS 1019158-02-1 appears in our catalog under these names: iST2-1, iST2-1, 98%, 2-(4-Methoxyphenyl)-1-([5-(2-nitrophenyl)furan-2-yl]methyl)pyrrolidine, 95%. Offered by: Biosynth, AmBeed, Combi-blocks. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 5g, 1g.
2-(4-methoxyphenyl)-1-[[5-(2-nitrophenyl)furan-2-yl]methyl]pyrrolidine (CAS 1019158-02-1) is a chemical compound with the molecular formula C22H22N2O4 and a molecular weight of 378.4 g/mol. IUPAC name: 2-(4-methoxyphenyl)-1-[[5-(2-nitrophenyl)furan-2-yl]methyl]pyrrolidine. InChIKey: RBVNERPDMZVXIP-UHFFFAOYSA-N.
| Molecular formula | C22H22N2O4 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-1-[[5-(2-nitrophenyl)furan-2-yl]methyl]pyrrolidine |
| InChIKey | RBVNERPDMZVXIP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2CCCN2CC3=CC=C(O3)C4=CC=CC=C4[N+](=O)[O-] |
Computed by PubChem (NCBI)