Products 201982-94-7

CAS 201982-94-7 is the registry number for Z-Ala-4MbetaNA. Offered by: Creative Peptides. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Benzyl N-[(2S)-1-[(4-methoxynaphthalen-2-yl)amino]-1-oxopropan-2-yl]carbamate (CAS 201982-94-7) is a chemical compound with the molecular formula C22H22N2O4 and a molecular weight of 378.4 g/mol. IUPAC name: benzyl N-[(2S)-1-[(4-methoxynaphthalen-2-yl)amino]-1-oxopropan-2-yl]carbamate. InChIKey: DQORNHPLFMGYMF-HNNXBMFYSA-N.

Identity
Molecular formulaC22H22N2O4
Molecular weight378.4 g/mol
IUPAC namebenzyl N-[(2S)-1-[(4-methoxynaphthalen-2-yl)amino]-1-oxopropan-2-yl]carbamate
InChIKeyDQORNHPLFMGYMF-HNNXBMFYSA-N
SMILESC[C@@H](C(=O)NC1=CC2=CC=CC=C2C(=C1)OC)NC(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)