CAS 201982-94-7 is the registry number for Z-Ala-4MbetaNA. Offered by: Creative Peptides. Available pack sizes: 1g, 5g.
Benzyl N-[(2S)-1-[(4-methoxynaphthalen-2-yl)amino]-1-oxopropan-2-yl]carbamate (CAS 201982-94-7) is a chemical compound with the molecular formula C22H22N2O4 and a molecular weight of 378.4 g/mol. IUPAC name: benzyl N-[(2S)-1-[(4-methoxynaphthalen-2-yl)amino]-1-oxopropan-2-yl]carbamate. InChIKey: DQORNHPLFMGYMF-HNNXBMFYSA-N.
| Molecular formula | C22H22N2O4 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | benzyl N-[(2S)-1-[(4-methoxynaphthalen-2-yl)amino]-1-oxopropan-2-yl]carbamate |
| InChIKey | DQORNHPLFMGYMF-HNNXBMFYSA-N |
| SMILES | C[C@@H](C(=O)NC1=CC2=CC=CC=C2C(=C1)OC)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)