Products 2782053-90-9
CAS 2782053-90-9 is the registry number for 5-chloro-2,3-dihydrofuro[3,2-b]pyridine-6-carbonitrile, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
5-chloro-2,3-dihydrofuro[3,2-b]pyridine-6-carbonitrile (CAS 2782053-90-9) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 5-chloro-2,3-dihydrofuro[3,2-b]pyridine-6-carbonitrile. InChIKey: MMWNCLDCJYXCIG-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 5-chloro-2,3-dihydrofuro[3,2-b]pyridine-6-carbonitrile |
| InChIKey | MMWNCLDCJYXCIG-UHFFFAOYSA-N |
| SMILES | C1COC2=C1N=C(C(=C2)C#N)Cl |
Computed by PubChem (NCBI)