Products 42523-29-5
CAS 42523-29-5 appears in our catalog under these names: 2,7-Dihydroxy-9-fluorenone, 2,7-Dihydroxy-9H-fluoren-9-one, >98.0%(HPLC)(T), 2,7-Dihydroxy-9-fluorenone 98%, 2,7-Dihydroxy-9-fluorenone, 98%+, 98%+, 2,7-Dihydroxy-9-fluorenone, min. 95 %, 250 g. Offered by: Biosynth, TCI, Ambeed, Chemat, Roth. Available pack sizes: 500g, 250g, 5g, 25g, 1000g, 1g, 10g, 100g.
2,7-dihydroxyfluoren-9-one (CAS 42523-29-5) is a chemical compound with the molecular formula C13H8O3 and a molecular weight of 212.20 g/mol. IUPAC name: 2,7-dihydroxyfluoren-9-one. InChIKey: CWHPQXRTQSNTRR-UHFFFAOYSA-N.
| Molecular formula | C13H8O3 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 2,7-dihydroxyfluoren-9-one |
| InChIKey | CWHPQXRTQSNTRR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=O)C3=C2C=CC(=C3)O |
Computed by PubChem (NCBI)