CAS 2788-73-0 appears in our catalog under these names: 1-Ethyl-2-methylbenzodiazole-5-carboxylic acid, 98%, 1-Ethyl-2-Methyl-1H-benzo(d)imidazole-5-carboxylic acid, 98%, 1-ETHYL-2-METHYLBENZODIAZOLE-5-CARBOXYLIC ACID, 98%, 98%, 1-Ethyl-2-methyl-1H-benzoimidazole-5-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100mg.
1-ethyl-2-methylbenzimidazole-5-carboxylic acid (CAS 2788-73-0) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 1-ethyl-2-methylbenzimidazole-5-carboxylic acid. InChIKey: CSZOHYLMFSLLFZ-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 1-ethyl-2-methylbenzimidazole-5-carboxylic acid |
| InChIKey | CSZOHYLMFSLLFZ-UHFFFAOYSA-N |
| SMILES | CCN1C(=NC2=C1C=CC(=C2)C(=O)O)C |
Computed by PubChem (NCBI)