CAS 27921-49-9 is the registry number for 4-Benzyl- 2-thiophenecarboxylic Acid. Offered by: TRC. Available pack sizes: 2,5g.
4-benzylthiophene-2-carboxylic acid (CAS 27921-49-9) is a chemical compound with the molecular formula C12H10O2S and a molecular weight of 218.27 g/mol. IUPAC name: 4-benzylthiophene-2-carboxylic acid. InChIKey: CVTUZGDJYOVVOT-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | 4-benzylthiophene-2-carboxylic acid |
| InChIKey | CVTUZGDJYOVVOT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CSC(=C2)C(=O)O |
Computed by PubChem (NCBI)