CAS 27939-30-6 is the registry number for (R)-2-Hydroxy-1,2-di(thiophen-2-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-hydroxy-1,2-dithiophen-2-ylethanone (CAS 27939-30-6) is a chemical compound with the molecular formula C10H8O2S2 and a molecular weight of 224.3 g/mol. IUPAC name: (2R)-2-hydroxy-1,2-dithiophen-2-ylethanone. InChIKey: OGWZIOZTPNLTCR-VIFPVBQESA-N.
| Molecular formula | C10H8O2S2 |
|---|---|
| Molecular weight | 224.3 g/mol |
| IUPAC name | (2R)-2-hydroxy-1,2-dithiophen-2-ylethanone |
| InChIKey | OGWZIOZTPNLTCR-VIFPVBQESA-N |
| SMILES | C1=CSC(=C1)[C@@H](C(=O)C2=CC=CS2)O |
Computed by PubChem (NCBI)