Products 98946-43-1

CAS 98946-43-1 is the registry number for 5-(thiophen-2-ylmethyl)thiophene-2-carboxylic acid. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-(thiophen-2-ylmethyl)thiophene-2-carboxylic acid (CAS 98946-43-1) is a chemical compound with the molecular formula C10H8O2S2 and a molecular weight of 224.3 g/mol. IUPAC name: 5-(thiophen-2-ylmethyl)thiophene-2-carboxylic acid. InChIKey: UTSHGUJMUGHQNH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8O2S2
Molecular weight224.3 g/mol
IUPAC name5-(thiophen-2-ylmethyl)thiophene-2-carboxylic acid
InChIKeyUTSHGUJMUGHQNH-UHFFFAOYSA-N
SMILESC1=CSC(=C1)CC2=CC=C(S2)C(=O)O

Computed by PubChem (NCBI)