Products 4408-82-6
CAS 4408-82-6 appears in our catalog under these names: 2,2-di(thiophen-2-yl)acetic acid, 2,2-Bis(thiophen-2-yl)acetic acid. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 2,5g, 250mg.
2,2-dithiophen-2-ylacetic acid (CAS 4408-82-6) is a chemical compound with the molecular formula C10H8O2S2 and a molecular weight of 224.3 g/mol. IUPAC name: 2,2-dithiophen-2-ylacetic acid. InChIKey: XOFMKTIZCDSXFR-UHFFFAOYSA-N.
| Molecular formula | C10H8O2S2 |
|---|---|
| Molecular weight | 224.3 g/mol |
| IUPAC name | 2,2-dithiophen-2-ylacetic acid |
| InChIKey | XOFMKTIZCDSXFR-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(C2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Di(2-thienyl)acetic acid, 2-Thiopheneacetic acid, .alpha.-2-thienyl-, Bis(thien-2-yl)acetic acid, 2-Thiopheneacetic acid, alpha-2-thienyl-, 4-19-00-03551 (Beilstein Handbook Reference), 2-Thiopheneacetic acid, alpha-2-thienyl-(9CI), 2,2-di(thiophen-2-yl)acetic acid, 2,2-bis(thiophen-2-yl)acetic acid, 2,2-dithiophen-2-ylacetic acid, 2,2-bis(2-Thienyl)acetic acid