CAS 40032-67-5 appears in our catalog under these names: 2-Hydroxy-1,2-di-3-thienyl-ethanone, 98%, 2-Hydroxy-1,2-di-3-thienyl-ethanone, 2-Hydroxy-1,2-di(thiophen-3-yl)ethanone, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 2,5g.
2-hydroxy-1,2-di(thiophen-3-yl)ethanone (CAS 40032-67-5) is a chemical compound with the molecular formula C10H8O2S2 and a molecular weight of 224.3 g/mol. IUPAC name: 2-hydroxy-1,2-di(thiophen-3-yl)ethanone. InChIKey: SCZZSZQLTIZGQT-UHFFFAOYSA-N.
| Molecular formula | C10H8O2S2 |
|---|---|
| Molecular weight | 224.3 g/mol |
| IUPAC name | 2-hydroxy-1,2-di(thiophen-3-yl)ethanone |
| InChIKey | SCZZSZQLTIZGQT-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1C(C(=O)C2=CSC=C2)O |
Computed by PubChem (NCBI)