Products 2794122-32-8
CAS 2794122-32-8 is the registry number for 3-Amino-1-((1R,2S)-2-fluorocyclopropyl)pyridin-2(1H)-one hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg.
3-amino-1-[(1R,2S)-2-fluorocyclopropyl]pyridin-2-one;hydrochloride (CAS 2794122-32-8) is a chemical compound with the molecular formula C8H10ClFN2O and a molecular weight of 204.63 g/mol. IUPAC name: 3-amino-1-[(1R,2S)-2-fluorocyclopropyl]pyridin-2-one;hydrochloride. InChIKey: AJJZQZFHRYWDLK-VOLNJMMDSA-N.
| Molecular formula | C8H10ClFN2O |
|---|---|
| Molecular weight | 204.63 g/mol |
| IUPAC name | 3-amino-1-[(1R,2S)-2-fluorocyclopropyl]pyridin-2-one;hydrochloride |
| InChIKey | AJJZQZFHRYWDLK-VOLNJMMDSA-N |
| SMILES | C1[C@H]([C@H]1F)N2C=CC=C(C2=O)N.Cl |
Computed by PubChem (NCBI)