CAS 2794997-00-3 is the registry number for 6-(Chloromethyl)indolin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(chloromethyl)-1,3-dihydroindol-2-one (CAS 2794997-00-3) is a chemical compound with the molecular formula C9H8ClNO and a molecular weight of 181.62 g/mol. IUPAC name: 6-(chloromethyl)-1,3-dihydroindol-2-one. InChIKey: OGUNLMNCGGCOOI-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 6-(chloromethyl)-1,3-dihydroindol-2-one |
| InChIKey | OGUNLMNCGGCOOI-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)CCl)NC1=O |
Computed by PubChem (NCBI)