CAS 27955-53-9 appears in our catalog under these names: 2-Phenylimidazo(1,2-a)pyrazin-3-amine, 98%, 2-Phenylimidazo(1,2-a)pyrazin-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-phenylimidazo[1,2-a]pyrazin-3-amine (CAS 27955-53-9) is a chemical compound with the molecular formula C12H10N4 and a molecular weight of 210.23 g/mol. IUPAC name: 2-phenylimidazo[1,2-a]pyrazin-3-amine. InChIKey: CVEAUYZTYNHIES-UHFFFAOYSA-N.
| Molecular formula | C12H10N4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2-phenylimidazo[1,2-a]pyrazin-3-amine |
| InChIKey | CVEAUYZTYNHIES-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N3C=CN=CC3=N2)N |
Computed by PubChem (NCBI)